![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01Teaser.flac | 2024-06-07 01:31 | 46M | |
| 02 People, People.flac | 2024-06-07 01:38 | 61M | |
| 03 The Grind.flac | 2024-06-07 01:48 | 26M | |
| 04 Stein Solo.flac | 2024-06-07 01:50 | 25M | |
| 05 Wild Dogs.flac | 2024-06-07 01:34 | 40M | |
| 06 Band Intro.flac | 2024-06-07 01:51 | 11M | |
| 07 Delightful.flac | 2024-06-07 01:43 | 43M | |
| 08 I fell In Love.flac | 2024-06-07 01:42 | 41M | |
| 09 Marching Powder (..> | 2024-06-07 01:45 | 100M | |
| 09 Marching Powder.flac | 2024-06-07 01:45 | 100M | |
| 10 Lotus.flac | 2024-06-07 01:41 | 50M | |
| 12-the_kinks-arthur_..> | 2024-06-07 01:33 | 13M | |
| 60. The Kinks - Do Y..> | 2024-06-07 01:30 | 5.4M | |
| 61. The Kinks - Anim..> | 2024-06-07 01:42 | 6.9M | |
| 62. The Kinks - Days..> | 2024-06-07 01:41 | 7.2M | |
| 101 - The Kinks - Vi..> | 2024-06-07 01:52 | 24M | |
| 102 - The Kinks - Ye..> | 2024-06-07 01:33 | 24M | |
| 103 - The Kinks - So..> | 2024-06-07 01:50 | 22M | |
| 104 - The Kinks - Dr..> | 2024-06-07 01:35 | 22M | |
| 105 - The Kinks - Br..> | 2024-06-07 01:35 | 17M | |
| 106 - The Kinks - Au..> | 2024-06-07 01:43 | 44M | |
| 107 - The Kinks - Sh..> | 2024-06-07 01:33 | 36M | |
| 108 - The Kinks - Mr..> | 2024-06-07 01:36 | 32M | |
| 110 - The Kinks - Yo..> | 2024-06-07 01:52 | 21M | |
| 111 - The Kinks - No..> | 2024-06-07 01:51 | 21M | |
| 112 - The Kinks - Ar..> | 2024-06-07 01:29 | 37M | |
| 113 - The Kinks - Pl..> | 2024-06-07 01:29 | 21M | |
| 114 - The Kinks - Vi..> | 2024-06-07 01:34 | 25M | |
| 115 - The Kinks - Ye..> | 2024-06-07 01:49 | 25M | |
| 116 - The Kinks - Dr..> | 2024-06-07 01:47 | 25M | |
| 117 - The Kinks - Br..> | 2024-06-07 01:49 | 18M | |
| 118 - The Kinks - Au..> | 2024-06-07 01:51 | 49M | |
| 119 - The Kinks - Sh..> | 2024-06-07 01:51 | 37M | |
| 201 - The Kinks - Vi..> | 2024-06-07 01:39 | 19M | |
| 202 - The Kinks - Ye..> | 2024-06-07 01:29 | 19M | |
| 203 - The Kinks - So..> | 2024-06-07 01:51 | 16M | |
| 204 - The Kinks - Dr..> | 2024-06-07 01:50 | 17M | |
| 205 - The Kinks - Br..> | 2024-06-07 01:46 | 14M | |
| 206 - The Kinks - Au..> | 2024-06-07 01:31 | 34M | |
| 207 - The Kinks - Sh..> | 2024-06-07 01:37 | 28M | |
| 208 - The Kinks - Mr..> | 2024-06-07 01:36 | 25M | |
| 209 - The Kinks - Sh..> | 2024-06-07 01:41 | 17M | |
| 210 - The Kinks - Yo..> | 2024-06-07 01:36 | 16M | |
| 211 - The Kinks - No..> | 2024-06-07 01:47 | 16M | |
| 212 - The Kinks - Ar..> | 2024-06-07 01:37 | 30M | |
| 213 - The Kinks - Pl..> | 2024-06-07 01:46 | 18M | |
| 214 - The Kinks - Ki..> | 2024-06-07 01:42 | 18M | |
| 215 - The Kinks - Vi..> | 2024-06-07 01:48 | 19M | |
| 216 - The Kinks - Au..> | 2024-06-07 01:32 | 35M | |
| 217 - The Kinks - Sh..> | 2024-06-07 01:31 | 26M | |
| 218 - The Kinks - Sh..> | 2024-06-07 01:37 | 16M | |
| 219 - The Kinks - Au..> | 2024-06-07 01:30 | 13M | |
| 301 - The Kinks - Th..> | 2024-06-07 01:34 | 18M | |
| 302 - The Kinks - Mi..> | 2024-06-07 01:41 | 22M | |
| 303 - The Kinks - Ho..> | 2024-06-07 01:33 | 22M | |
| 304 - The Kinks - Do..> | 2024-06-07 01:37 | 20M | |
| 305 - The Kinks - Ar..> | 2024-06-07 01:46 | 27M | |
| 306 - The Kinks - Cr..> | 2024-06-07 01:34 | 23M | |
| 307 - The Kinks - Im..> | 2024-06-07 01:33 | 18M | |
| 308 - The Kinks - Li..> | 2024-06-07 01:45 | 24M | |
| 309 - The Kinks - Mr..> | 2024-06-07 01:46 | 22M | |
| 310 - The Kinks - Mr..> | 2024-06-07 01:48 | 27M | |
| 311 - The Kinks - Gr..> | 2024-06-07 01:41 | 17M | |
| 312 - The Kinks - Th..> | 2024-06-07 01:51 | 12M | |
| 313 - The Kinks - Li..> | 2024-06-07 01:30 | 17M | |
| 314 - The Kinks - Th..> | 2024-06-07 01:39 | 11M | |
| 315 - The Kinks - Ho..> | 2024-06-07 01:34 | 19M | |
| 316 - The Kinks - Cr..> | 2024-06-07 01:37 | 19M | |
| 317 - The Kinks - Mi..> | 2024-06-07 01:47 | 17M | |
| 318 - The Kinks - Th..> | 2024-06-07 01:46 | 15M | |
| 319 - The Kinks - Mr..> | 2024-06-07 01:48 | 22M | |
| 320 - The Kinks - Mr..> | 2024-06-07 01:52 | 32M | |
| 321 - The Kinks - Gr..> | 2024-06-07 01:46 | 22M | |
| 322 - The Kinks - Li..> | 2024-06-07 01:39 | 23M | |
| 323 - The Kinks - Ho..> | 2024-06-07 01:45 | 16M | |
| 401 - The Kinks - Ar..> | 2024-06-07 01:32 | 7.7M | |
| 402 - The Kinks - Au..> | 2024-06-07 01:40 | 42M | |
| 403 - The Kinks - Ho..> | 2024-06-07 01:42 | 36M | |
| 404 - The Kinks - Sh..> | 2024-06-07 01:39 | 36M | |
| 405 - The Kinks - My..> | 2024-06-07 01:50 | 6.1M | |
| 406 - The Kinks - St..> | 2024-06-07 01:47 | 9.3M | |
| 407 - The Kinks - Sp..> | 2024-06-07 01:33 | 19M | |
| 408 - The Kinks - Th..> | 2024-06-07 01:39 | 12M | |
| 409 - The Kinks - Ar..> | 2024-06-07 01:36 | 20M | |
| 410 - The Kinks - Th..> | 2024-06-07 01:46 | 12M | |
| 411 - The Kinks - So..> | 2024-06-07 01:45 | 3.9M | |
| 412 - The Kinks - Ki..> | 2024-06-07 01:33 | 12M | |
| 413 - The Kinks - Vi..> | 2024-06-07 01:30 | 22M | |
| 414 - The Kinks - Ar..> | 2024-06-07 01:47 | 16M | |
| Courtney Pine - Back..> | 2024-06-07 01:37 | 5.3M | |
| Track101.flac | 2024-06-07 01:29 | 15M | |
| Track102.flac | 2024-06-07 01:40 | 13M | |
| Track103.flac | 2024-06-07 01:45 | 14M | |
| Track104.flac | 2024-06-07 01:46 | 8.4M | |
| Track105.flac | 2024-06-07 01:47 | 15M | |
| Track106.flac | 2024-06-07 01:39 | 17M | |
| Track107.flac | 2024-06-07 01:32 | 25M | |
| Track108.flac | 2024-06-07 01:45 | 17M | |
| Track109.flac | 2024-06-07 01:36 | 13M | |
| Track110 (1).flac | 2024-06-07 01:43 | 23M | |
| Track110.flac | 2024-06-07 01:35 | 23M | |
| Track111.flac | 2024-06-07 01:41 | 44M | |
| Track112.flac | 2024-06-07 01:42 | 25M | |
| Track113.flac | 2024-06-07 01:35 | 35M | |
| Track114.flac | 2024-06-07 01:30 | 35M | |
| Track115.flac | 2024-06-07 01:49 | 20M | |
| Track116.flac | 2024-06-07 01:50 | 30M | |
| Track117.flac | 2024-06-07 01:40 | 26M | |
| Track118.flac | 2024-06-07 01:31 | 18M | |
| Track119.flac | 2024-06-07 01:36 | 37M | |
| Track201.flac | 2024-06-07 01:31 | 49M | |
| Track202.flac | 2024-06-07 01:32 | 24M | |
| Track203.flac | 2024-06-07 01:29 | 12M | |
| Track204.flac | 2024-06-07 01:50 | 16M | |
| Track205.flac | 2024-06-07 01:49 | 7.4M | |
| Track206.flac | 2024-06-07 01:31 | 15M | |
| Track207.flac | 2024-06-07 01:40 | 12M | |
| Track208.flac | 2024-06-07 01:31 | 18M | |
| Track209.flac | 2024-06-07 01:35 | 17M | |
| Track210.flac | 2024-06-07 01:49 | 19M | |
| Track211.flac | 2024-06-07 01:52 | 8.3M | |
| Track212.flac | 2024-06-07 01:39 | 21M | |
| Track213.flac | 2024-06-07 01:37 | 37M | |
| Track214.flac | 2024-06-07 01:41 | 33M | |
| Track215 (1).flac | 2024-06-07 01:40 | 47M | |
| Track215.flac | 2024-06-07 01:32 | 47M | |
| Track216.flac | 2024-06-07 01:49 | 110M | |
| Track301.flac | 2024-06-07 01:36 | 32M | |
| Track302.flac | 2024-06-07 01:47 | 32M | |
| Track303.flac | 2024-06-07 01:42 | 37M | |
| Track304.flac | 2024-06-07 01:35 | 28M | |
| Track305.flac | 2024-06-07 01:38 | 37M | |
| Track306.flac | 2024-06-07 01:38 | 16M | |
| Track307.flac | 2024-06-07 01:46 | 30M | |
| Track308.flac | 2024-06-07 01:48 | 18M | |
| Track309.flac | 2024-06-07 01:43 | 28M | |
| folder.jpg | 2024-06-07 01:32 | 182K | |
